C24H25N5O2S — CID 155215032
N'-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)phenyl]methanediamine (PubChem CID 155215032) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is N'-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)phenyl]methanediamine.
| Compound Name | N'-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)phenyl]methanediamine |
|---|---|
| PubChem CID | 155215032 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N'-(5-tert-butyl-1,2-oxazol-3-yl)-N-[4-(6-methoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)phenyl]methanediamine |
| SMILES | COc1ccc2c(c1)sc1nc(-c3ccc(NCNc4cc(C(C)(C)C)on4)cc3)cn12 |
| InChI | InChI=1S/C24H25N5O2S/c1-24(2,3)21-12-22(28-31-21)26-14-25-16-7-5-15(6-8-16)18-13-29-19-10-9-17(30-4)11-20(19)32-23(29)27-18/h5-13,25H,14H2,1-4H3,(H,26,28) |
| InChIKey | BTSWKDAGKFMZNM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|