C18H36OS — CID 155215269
7-tert-butylsulfanyl-2,4,4,6,6,7-hexamethyloctan-3-one (PubChem CID 155215269) has the molecular formula C18H36OS and a molecular weight of 300.55 g/mol. Its IUPAC name is 7-tert-butylsulfanyl-2,4,4,6,6,7-hexamethyloctan-3-one.
| Compound Name | 7-tert-butylsulfanyl-2,4,4,6,6,7-hexamethyloctan-3-one |
|---|---|
| PubChem CID | 155215269 |
| Molecular Formula | C18H36OS |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 7-tert-butylsulfanyl-2,4,4,6,6,7-hexamethyloctan-3-one |
| SMILES | CC(C)C(=O)C(C)(C)CC(C)(C)C(C)(C)SC(C)(C)C |
| InChI | InChI=1S/C18H36OS/c1-13(2)14(19)16(6,7)12-17(8,9)18(10,11)20-15(3,4)5/h13H,12H2,1-11H3 |
| InChIKey | BWGVCKVMYCKYFE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |