About 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine
5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine (PubChem CID 155215271) has the molecular formula C20H37NO
and a molecular weight of 307.52 g/mol. Its IUPAC name is 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine.
Molecular Properties
| Compound Name | 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine |
| PubChem CID | 155215271 |
| Molecular Formula | C20H37NO |
| Molecular Weight | 307.52 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine |
| SMILES | C=C(C)NC(=C)CCCOC(=C)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H37NO/c1-15(2)21-16(3)12-11-13-22-17(4)18(20(8,9)10)14-19(5,6)7/h18,21H,1,3-4,11-14H2,2,5-10H3 |
| InChIKey | KBUMNRXIOAFWBJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine?
The IUPAC name of 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine (CID 155215271) is 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine.
What is the SMILES notation for 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine?
The canonical SMILES for 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine is C=C(C)NC(=C)CCCOC(=C)C(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine?
The InChIKey is KBUMNRXIOAFWBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO/c1-15(2)21-16(3)12-11-13-22-17(4)18(20(8,9)10)14-19(5,6)7/h18,21H,1,3-4,11-14H2,2,5-10H3.
What are the key properties of 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine?
5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine has a molecular weight of 307.52 g/mol, XLogP of 6.03, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-tert-butyl-5,5-dimethylhex-1-en-2-yl)oxy-N-prop-1-en-2-ylpent-1-en-2-amine is sourced from PubChem (CID 155215271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).