C17H32N2 — CID 155215817
4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3E)-4-methylhexa-1,3-dien-3-yl]cyclohexane-1,4-diamine (PubChem CID 155215817) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3E)-4-methylhexa-1,3-dien-3-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3E)-4-methylhexa-1,3-dien-3-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 155215817 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 4-N-ethyl-1-N,1-N-dimethyl-4-N-[(3E)-4-methylhexa-1,3-dien-3-yl]cyclohexane-1,4-diamine |
| SMILES | C=C/C(=C(/C)CC)N(CC)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C17H32N2/c1-7-14(4)17(8-2)19(9-3)16-12-10-15(11-13-16)18(5)6/h8,15-16H,2,7,9-13H2,1,3-6H3/b17-14+ |
| InChIKey | PJOPCDUWWOAIHN-SAPNQHFASA-N |
| XLogP | 4.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|