About [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate
[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate (PubChem CID 155215903) has the molecular formula C13H13N3O7
and a molecular weight of 323.26 g/mol. Its IUPAC name is [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate.
Molecular Properties
| Compound Name | [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate |
| PubChem CID | 155215903 |
| Molecular Formula | C13H13N3O7 |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate |
| SMILES | CC(=O)ON1C(=O)CC(NC(=O)CCN2C(=O)C=CC2=O)C1=O |
| InChI | InChI=1S/C13H13N3O7/c1-7(17)23-16-12(21)6-8(13(16)22)14-9(18)4-5-15-10(19)2-3-11(15)20/h2-3,8H,4-6H2,1H3,(H,14,18) |
| InChIKey | WVBSUYLLFVDCNR-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate?
The IUPAC name of [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate (CID 155215903) is [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate.
What is the SMILES notation for [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate?
The canonical SMILES for [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate is CC(=O)ON1C(=O)CC(NC(=O)CCN2C(=O)C=CC2=O)C1=O.
What is the InChIKey of [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate?
The InChIKey is WVBSUYLLFVDCNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O7/c1-7(17)23-16-12(21)6-8(13(16)22)14-9(18)4-5-15-10(19)2-3-11(15)20/h2-3,8H,4-6H2,1H3,(H,14,18).
What are the key properties of [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate?
[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate has a molecular weight of 323.26 g/mol, XLogP of -1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-2,5-dioxopyrrolidin-1-yl] acetate is sourced from PubChem (CID 155215903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).