About N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide
N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide (PubChem CID 155215925) has the molecular formula C24H33N2P
and a molecular weight of 380.52 g/mol. Its IUPAC name is N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide.
Molecular Properties
| Compound Name | N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide |
| PubChem CID | 155215925 |
| Molecular Formula | C24H33N2P |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide |
| SMILES | CC(C)(C)N/C(=N\CC1CCCCC1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H33N2P/c1-24(2,3)26-23(25-19-20-13-7-4-8-14-20)27(21-15-9-5-10-16-21)22-17-11-6-12-18-22/h5-6,9-12,15-18,20H,4,7-8,13-14,19H2,1-3H3,(H,25,26) |
| InChIKey | PBAKUTASKRRPPJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide?
The IUPAC name of N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide (CID 155215925) is N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide.
What is the SMILES notation for N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide?
The canonical SMILES for N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide is CC(C)(C)N/C(=N\CC1CCCCC1)P(c1ccccc1)c1ccccc1.
What is the InChIKey of N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide?
The InChIKey is PBAKUTASKRRPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N2P/c1-24(2,3)26-23(25-19-20-13-7-4-8-14-20)27(21-15-9-5-10-16-21)22-17-11-6-12-18-22/h5-6,9-12,15-18,20H,4,7-8,13-14,19H2,1-3H3,(H,25,26).
What are the key properties of N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide?
N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide has a molecular weight of 380.52 g/mol, XLogP of 5.44, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-(cyclohexylmethyl)-1-diphenylphosphanylmethanimidamide is sourced from PubChem (CID 155215925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).