C10H13N3 — CID 155216850
1-(4-ethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole (PubChem CID 155216850) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(4-ethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole.
| Compound Name | 1-(4-ethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 155216850 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(4-ethylcyclohexa-2,4-dien-1-yl)-1,2,4-triazole |
| SMILES | CCC1=CCC(n2cncn2)C=C1 |
| InChI | InChI=1S/C10H13N3/c1-2-9-3-5-10(6-4-9)13-8-11-7-12-13/h3-5,7-8,10H,2,6H2,1H3 |
| InChIKey | FGGWZBDAJAEBNF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |