About 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine
6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine (PubChem CID 155216911) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine |
| PubChem CID | 155216911 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine |
| SMILES | C1=CC(C2CC=CS2)=NCC1 |
| InChI | InChI=1S/C9H11NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1,3-4,7,9H,2,5-6H2 |
| InChIKey | JJEVPOCDHVYEFN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine?
The IUPAC name of 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine (CID 155216911) is 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine.
What is the SMILES notation for 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine?
The canonical SMILES for 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine is C1=CC(C2CC=CS2)=NCC1.
What is the InChIKey of 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine?
The InChIKey is JJEVPOCDHVYEFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1,3-4,7,9H,2,5-6H2.
What are the key properties of 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine?
6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine has a molecular weight of 165.26 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydrothiophen-2-yl)-2,3-dihydropyridine is sourced from PubChem (CID 155216911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).