About 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine
1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine (PubChem CID 155217221) has the molecular formula C8H11F4N
and a molecular weight of 197.17 g/mol. Its IUPAC name is 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine |
| PubChem CID | 155217221 |
| Molecular Formula | C8H11F4N |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine |
| SMILES | C=C(F)[C@@H](N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H11F4N/c1-6(9)7(8(10,11)12)13-4-2-3-5-13/h7H,1-5H2/t7-/m1/s1 |
| InChIKey | UPGXHXVUFAQVNF-SSDOTTSWSA-N |
| XLogP | 2.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine?
The IUPAC name of 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine (CID 155217221) is 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine.
What is the SMILES notation for 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine?
The canonical SMILES for 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine is C=C(F)[C@@H](N1CCCC1)C(F)(F)F.
What is the InChIKey of 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine?
The InChIKey is UPGXHXVUFAQVNF-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H11F4N/c1-6(9)7(8(10,11)12)13-4-2-3-5-13/h7H,1-5H2/t7-/m1/s1.
What are the key properties of 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine?
1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine has a molecular weight of 197.17 g/mol, XLogP of 2.50, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-1,1,1,3-tetrafluorobut-3-en-2-yl]pyrrolidine is sourced from PubChem (CID 155217221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).