C11H4F19NO2 — CID 155217366
2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)-4-[1,2,2-trifluoro-2-(2,2,3,3-tetrafluoropropoxy)ethyl]morpholine (PubChem CID 155217366) has the molecular formula C11H4F19NO2 and a molecular weight of 543.12 g/mol. Its IUPAC name is 2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)-4-[1,2,2-trifluoro-2-(2,2,3,3-tetrafluoropropoxy)ethyl]morpholine.
| Compound Name | 2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)-4-[1,2,2-trifluoro-2-(2,2,3,3-tetrafluoropropoxy)ethyl]morpholine |
|---|---|
| PubChem CID | 155217366 |
| Molecular Formula | C11H4F19NO2 |
| Molecular Weight | 543.12 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | 2,3,3,5,5,6-hexafluoro-2,6-bis(trifluoromethyl)-4-[1,2,2-trifluoro-2-(2,2,3,3-tetrafluoropropoxy)ethyl]morpholine |
| SMILES | FC(F)C(F)(F)COC(F)(F)C(F)N1C(F)(F)C(F)(C(F)(F)F)OC(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C11H4F19NO2/c12-2(13)4(15,16)1-32-5(17,18)3(14)31-10(27,28)6(19,8(21,22)23)33-7(20,9(24,25)26)11(31,29)30/h2-3H,1H2 |
| InChIKey | UPLDMIIYHNWBJY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.12 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|