About N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine
N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine (PubChem CID 155217665) has the molecular formula C12H15F2NS
and a molecular weight of 243.32 g/mol. Its IUPAC name is N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine.
Molecular Properties
| Compound Name | N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine |
| PubChem CID | 155217665 |
| Molecular Formula | C12H15F2NS |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine |
| SMILES | C=CCCc1c(F)cc(SNCC)cc1F |
| InChI | InChI=1S/C12H15F2NS/c1-3-5-6-10-11(13)7-9(8-12(10)14)16-15-4-2/h3,7-8,15H,1,4-6H2,2H3 |
| InChIKey | ZNURITQQIYTILU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine?
The IUPAC name of N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine (CID 155217665) is N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine.
What is the SMILES notation for N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine?
The canonical SMILES for N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine is C=CCCc1c(F)cc(SNCC)cc1F.
What is the InChIKey of N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine?
The InChIKey is ZNURITQQIYTILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NS/c1-3-5-6-10-11(13)7-9(8-12(10)14)16-15-4-2/h3,7-8,15H,1,4-6H2,2H3.
What are the key properties of N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine?
N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine has a molecular weight of 243.32 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-but-3-enyl-3,5-difluorophenyl)sulfanylethanamine is sourced from PubChem (CID 155217665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).