C18H29F2NS — CID 155217707
(4Z)-5,7-difluoro-6-methyl-9-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfanylnona-1,4-dien-2-amine (PubChem CID 155217707) has the molecular formula C18H29F2NS and a molecular weight of 329.50 g/mol. Its IUPAC name is (4Z)-5,7-difluoro-6-methyl-9-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfanylnona-1,4-dien-2-amine.
| Compound Name | (4Z)-5,7-difluoro-6-methyl-9-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfanylnona-1,4-dien-2-amine |
|---|---|
| PubChem CID | 155217707 |
| Molecular Formula | C18H29F2NS |
| Molecular Weight | 329.50 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (4Z)-5,7-difluoro-6-methyl-9-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfanylnona-1,4-dien-2-amine |
| SMILES | C=C(N)C/C=C(\F)C(C)C(F)CCSC(C)/C(C)=C/C=C\C |
| InChI | InChI=1S/C18H29F2NS/c1-6-7-8-13(2)16(5)22-12-11-18(20)15(4)17(19)10-9-14(3)21/h6-8,10,15-16,18H,3,9,11-12,21H2,1-2,4-5H3/b7-6-,13-8+,17-10- |
| InChIKey | SALWSXWDIZGTQU-WCUIHYKRSA-N |
| XLogP | 5.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|