C18H15F5N4O — CID 155217757
1-methyl-1-[3-methyl-2-[[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]oxymethyl]phenyl]hydrazine (PubChem CID 155217757) has the molecular formula C18H15F5N4O and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-methyl-1-[3-methyl-2-[[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]oxymethyl]phenyl]hydrazine.
| Compound Name | 1-methyl-1-[3-methyl-2-[[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]oxymethyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 155217757 |
| Molecular Formula | C18H15F5N4O |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-methyl-1-[3-methyl-2-[[1-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-yl]oxymethyl]phenyl]hydrazine |
| SMILES | Cc1cccc(N(C)N)c1COc1ccn(-c2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C18H15F5N4O/c1-9-4-3-5-11(26(2)24)10(9)8-28-12-6-7-27(25-12)18-16(22)14(20)13(19)15(21)17(18)23/h3-7H,8,24H2,1-2H3 |
| InChIKey | ZQFGXCVGYRLVII-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|