C25H24F4N4O3 — CID 155218266
N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methylphenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide (PubChem CID 155218266) has the molecular formula C25H24F4N4O3 and a molecular weight of 504.48 g/mol. Its IUPAC name is N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methylphenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide.
| Compound Name | N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methylphenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide |
|---|---|
| PubChem CID | 155218266 |
| Molecular Formula | C25H24F4N4O3 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-ethyl-N-[(Z)-N-[[7-fluoro-2-(2-methylphenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]formamide |
| SMILES | C=C(c1cn(-c2ccccc2C)c(=O)c2cc(F)c(N(C)/N=C(/CO)N(C=O)CC)cc12)C(F)(F)F |
| InChI | InChI=1S/C25H24F4N4O3/c1-5-32(14-35)23(13-34)30-31(4)22-11-17-18(10-20(22)26)24(36)33(21-9-7-6-8-15(21)2)12-19(17)16(3)25(27,28)29/h6-12,14,34H,3,5,13H2,1-2,4H3/b30-23- |
| InChIKey | CMAOKBKCEOARCH-WMMMYUQOSA-N |
| XLogP | 4.23 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|