C15H15N3O4 — CID 155218359
2-(2,6-dioxopiperidin-3-yl)-7-methyl-4,6-dihydropyrido[3,4-c]azepine-1,3-dione (PubChem CID 155218359) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-7-methyl-4,6-dihydropyrido[3,4-c]azepine-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-7-methyl-4,6-dihydropyrido[3,4-c]azepine-1,3-dione |
|---|---|
| PubChem CID | 155218359 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-7-methyl-4,6-dihydropyrido[3,4-c]azepine-1,3-dione |
| SMILES | CC1=NC=C2C(=O)N(C3CCC(=O)NC3=O)C(=O)CC2=CC1 |
| InChI | InChI=1S/C15H15N3O4/c1-8-2-3-9-6-13(20)18(15(22)10(9)7-16-8)11-4-5-12(19)17-14(11)21/h3,7,11H,2,4-6H2,1H3,(H,17,19,21) |
| InChIKey | GGTIJQFQACSFBE-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|