About 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine
1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine (PubChem CID 15521900) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine |
| PubChem CID | 15521900 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine |
| SMILES | NCc1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C8H9N3/c9-4-7-3-6-1-2-10-8(6)5-11-7/h1-3,5,10H,4,9H2 |
| InChIKey | AXCSAAHUNFWNFI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine?
The IUPAC name of 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine (CID 15521900) is 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine.
What is the SMILES notation for 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine?
The canonical SMILES for 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine is NCc1cc2cc[nH]c2cn1.
What is the InChIKey of 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine?
The InChIKey is AXCSAAHUNFWNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c9-4-7-3-6-1-2-10-8(6)5-11-7/h1-3,5,10H,4,9H2.
What are the key properties of 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine?
1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine has a molecular weight of 147.18 g/mol, XLogP of 1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-c]pyridin-5-ylmethanamine is sourced from PubChem (CID 15521900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).