C30H46O5 — CID 155219734
(6R)-6-[(2S,8S,9S,13R,16R,17R)-11-hydroxy-2,8,17-trimethyl-19-oxo-6-oxatetracyclo[10.7.0.02,9.013,17]nonadec-1(12)-en-16-yl]-2-methyl-3-methylideneheptanoic acid (PubChem CID 155219734) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (6R)-6-[(2S,8S,9S,13R,16R,17R)-11-hydroxy-2,8,17-trimethyl-19-oxo-6-oxatetracyclo[10.7.0.02,9.013,17]nonadec-1(12)-en-16-yl]-2-methyl-3-methylideneheptanoic acid.
| Compound Name | (6R)-6-[(2S,8S,9S,13R,16R,17R)-11-hydroxy-2,8,17-trimethyl-19-oxo-6-oxatetracyclo[10.7.0.02,9.013,17]nonadec-1(12)-en-16-yl]-2-methyl-3-methylideneheptanoic acid |
|---|---|
| PubChem CID | 155219734 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (6R)-6-[(2S,8S,9S,13R,16R,17R)-11-hydroxy-2,8,17-trimethyl-19-oxo-6-oxatetracyclo[10.7.0.02,9.013,17]nonadec-1(12)-en-16-yl]-2-methyl-3-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C)[C@H]1CC[C@H]2C3=C(C(=O)C[C@]12C)[C@@]1(C)CCCOC[C@@H](C)[C@@H]1CC3O)C(C)C(=O)O |
| InChI | InChI=1S/C30H46O5/c1-17(20(4)28(33)34)8-9-18(2)21-10-11-22-26-24(31)14-23-19(3)16-35-13-7-12-29(23,5)27(26)25(32)15-30(21,22)6/h18-24,31H,1,7-16H2,2-6H3,(H,33,34)/t18-,19-,20?,21-,22+,23+,24?,29+,30-/m1/s1 |
| InChIKey | VNFQOYCWCZMUKU-NAWCLYIXSA-N |
| XLogP | 5.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|