C31H36N4O6 — CID 155219747
tert-butyl N-benzyl-N-[2-[[(2E,4E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-5-(methylideneamino)penta-2,4-dien-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 155219747) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[2-[[(2E,4E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-5-(methylideneamino)penta-2,4-dien-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[2-[[(2E,4E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-5-(methylideneamino)penta-2,4-dien-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 155219747 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | tert-butyl N-benzyl-N-[2-[[(2E,4E)-5-(6,7-dimethoxyquinolin-4-yl)oxy-5-(methylideneamino)penta-2,4-dien-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | C=N/C(=C\C=C(/C)NC(=O)CN(Cc1ccccc1)C(=O)OC(C)(C)C)Oc1ccnc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C31H36N4O6/c1-21(34-28(36)20-35(30(37)41-31(2,3)4)19-22-11-9-8-10-12-22)13-14-29(32-5)40-25-15-16-33-24-18-27(39-7)26(38-6)17-23(24)25/h8-18H,5,19-20H2,1-4,6-7H3,(H,34,36)/b21-13+,29-14+ |
| InChIKey | AXRHCUKFLSBRNV-JCCOHWFUSA-N |
| XLogP | 5.63 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|