C16H18F3NO4S — CID 15522003
methyl 2-(benzenesulfonamido)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoropropanoate (PubChem CID 15522003) has the molecular formula C16H18F3NO4S and a molecular weight of 377.38 g/mol. Its IUPAC name is methyl 2-(benzenesulfonamido)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-(benzenesulfonamido)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 15522003 |
| Molecular Formula | C16H18F3NO4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 2-(benzenesulfonamido)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(CC1=CCCC1)(NS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO4S/c1-24-14(21)15(16(17,18)19,11-12-7-5-6-8-12)20-25(22,23)13-9-3-2-4-10-13/h2-4,7,9-10,20H,5-6,8,11H2,1H3 |
| InChIKey | QSXLPTUNPUPTOC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|