C12H11ClFN5 — CID 155220137
N-[(1E,3E)-2-(4-chloro-8-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine (PubChem CID 155220137) has the molecular formula C12H11ClFN5 and a molecular weight of 279.71 g/mol. Its IUPAC name is N-[(1E,3E)-2-(4-chloro-8-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-2-(4-chloro-8-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 155220137 |
| Molecular Formula | C12H11ClFN5 |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-[(1E,3E)-2-(4-chloro-8-methylpyrazolo[1,5-a][1,3,5]triazin-2-yl)-4-fluoropenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)F)c1nc(Cl)n2ncc(C)c2n1 |
| InChI | InChI=1S/C12H11ClFN5/c1-7-5-16-19-11(7)17-10(18-12(19)13)9(6-15-3)4-8(2)14/h4-6H,3H2,1-2H3/b8-4+,9-6+ |
| InChIKey | YLVYSNILSYBFDT-HNJDCKIISA-N |
| XLogP | 3.00 |
| TPSA | 55.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|