C21H29N3O2 — CID 155220650
4-[(1S,5S)-6-(4-ethoxyphenyl)-8,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]-4-oxobutanenitrile (PubChem CID 155220650) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-[(1S,5S)-6-(4-ethoxyphenyl)-8,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]-4-oxobutanenitrile.
| Compound Name | 4-[(1S,5S)-6-(4-ethoxyphenyl)-8,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]-4-oxobutanenitrile |
|---|---|
| PubChem CID | 155220650 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-[(1S,5S)-6-(4-ethoxyphenyl)-8,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]-4-oxobutanenitrile |
| SMILES | CCOc1ccc(N2C[C@H]3CN(C(=O)CCC#N)C[C@@H]2C(C)C3C)cc1 |
| InChI | InChI=1S/C21H29N3O2/c1-4-26-19-9-7-18(8-10-19)24-13-17-12-23(21(25)6-5-11-22)14-20(24)16(3)15(17)2/h7-10,15-17,20H,4-6,12-14H2,1-3H3/t15?,16?,17-,20-/m1/s1 |
| InChIKey | GXHJMCWKTQXWMH-AEBIURJHSA-N |
| XLogP | 3.31 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|