C14H15F3O4S — CID 155222030
[(5E)-2-methoxy-7,8,9,10-tetrahydrobenzo[8]annulen-6-yl] trifluoromethanesulfonate (PubChem CID 155222030) has the molecular formula C14H15F3O4S and a molecular weight of 336.33 g/mol. Its IUPAC name is [(5E)-2-methoxy-7,8,9,10-tetrahydrobenzo[8]annulen-6-yl] trifluoromethanesulfonate.
| Compound Name | [(5E)-2-methoxy-7,8,9,10-tetrahydrobenzo[8]annulen-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155222030 |
| Molecular Formula | C14H15F3O4S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [(5E)-2-methoxy-7,8,9,10-tetrahydrobenzo[8]annulen-6-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)CCCC/C(OS(=O)(=O)C(F)(F)F)=C\2 |
| InChI | InChI=1S/C14H15F3O4S/c1-20-12-7-6-11-9-13(5-3-2-4-10(11)8-12)21-22(18,19)14(15,16)17/h6-9H,2-5H2,1H3/b13-9+ |
| InChIKey | SVLAMBWEEAYIQU-UKTHLTGXSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|