About 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol
2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol (PubChem CID 155222081) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol.
Molecular Properties
| Compound Name | 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol |
| PubChem CID | 155222081 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol |
| SMILES | Oc1ccccc1C1=Cc2ccccc2CCC1 |
| InChI | InChI=1S/C17H16O/c18-17-11-4-3-10-16(17)15-9-5-8-13-6-1-2-7-14(13)12-15/h1-4,6-7,10-12,18H,5,8-9H2 |
| InChIKey | VKZKRELLUSNILU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol?
The IUPAC name of 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol (CID 155222081) is 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol.
What is the SMILES notation for 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol?
The canonical SMILES for 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol is Oc1ccccc1C1=Cc2ccccc2CCC1.
What is the InChIKey of 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol?
The InChIKey is VKZKRELLUSNILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O/c18-17-11-4-3-10-16(17)15-9-5-8-13-6-1-2-7-14(13)12-15/h1-4,6-7,10-12,18H,5,8-9H2.
What are the key properties of 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol?
2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol has a molecular weight of 236.31 g/mol, XLogP of 4.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenol is sourced from PubChem (CID 155222081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).