C26H34N2O2S — CID 155222132
5-[4-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenyl]sulfanylpentyl 2,3-diamino-2-methylpropanoate (PubChem CID 155222132) has the molecular formula C26H34N2O2S and a molecular weight of 438.64 g/mol. Its IUPAC name is 5-[4-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenyl]sulfanylpentyl 2,3-diamino-2-methylpropanoate.
| Compound Name | 5-[4-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenyl]sulfanylpentyl 2,3-diamino-2-methylpropanoate |
|---|---|
| PubChem CID | 155222132 |
| Molecular Formula | C26H34N2O2S |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 5-[4-(8,9-dihydro-7H-benzo[7]annulen-6-yl)phenyl]sulfanylpentyl 2,3-diamino-2-methylpropanoate |
| SMILES | CC(N)(CN)C(=O)OCCCCCSc1ccc(C2=Cc3ccccc3CCC2)cc1 |
| InChI | InChI=1S/C26H34N2O2S/c1-26(28,19-27)25(29)30-16-5-2-6-17-31-24-14-12-21(13-15-24)23-11-7-10-20-8-3-4-9-22(20)18-23/h3-4,8-9,12-15,18H,2,5-7,10-11,16-17,19,27-28H2,1H3 |
| InChIKey | FFSKWCUDVHMYHZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|