About 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate
3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate (PubChem CID 155222266) has the molecular formula C22H26N2O2
and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate.
Molecular Properties
| Compound Name | 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate |
| PubChem CID | 155222266 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate |
| SMILES | NCC(N)C(=O)OCCCc1ccc2c(c1)C=C(c1ccccc1)CC2 |
| InChI | InChI=1S/C22H26N2O2/c23-15-21(24)22(25)26-12-4-5-16-8-9-18-10-11-19(14-20(18)13-16)17-6-2-1-3-7-17/h1-3,6-9,13-14,21H,4-5,10-12,15,23-24H2 |
| InChIKey | WDQPFFSKIUPVGR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate?
The IUPAC name of 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate (CID 155222266) is 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate.
What is the SMILES notation for 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate?
The canonical SMILES for 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate is NCC(N)C(=O)OCCCc1ccc2c(c1)C=C(c1ccccc1)CC2.
What is the InChIKey of 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate?
The InChIKey is WDQPFFSKIUPVGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O2/c23-15-21(24)22(25)26-12-4-5-16-8-9-18-10-11-19(14-20(18)13-16)17-6-2-1-3-7-17/h1-3,6-9,13-14,21H,4-5,10-12,15,23-24H2.
What are the key properties of 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate?
3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate has a molecular weight of 350.46 g/mol, XLogP of 2.94, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-phenyl-5,6-dihydronaphthalen-2-yl)propyl 2,3-diaminopropanoate is sourced from PubChem (CID 155222266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).