C15H28O2 — CID 155222316
3-[(2S,4R,6R)-6-tert-butyl-4,5,5-trimethyloxan-2-yl]propanal (PubChem CID 155222316) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-[(2S,4R,6R)-6-tert-butyl-4,5,5-trimethyloxan-2-yl]propanal.
| Compound Name | 3-[(2S,4R,6R)-6-tert-butyl-4,5,5-trimethyloxan-2-yl]propanal |
|---|---|
| PubChem CID | 155222316 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-[(2S,4R,6R)-6-tert-butyl-4,5,5-trimethyloxan-2-yl]propanal |
| SMILES | C[C@@H]1C[C@H](CCC=O)O[C@H](C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C15H28O2/c1-11-10-12(8-7-9-16)17-13(14(2,3)4)15(11,5)6/h9,11-13H,7-8,10H2,1-6H3/t11-,12+,13-/m1/s1 |
| InChIKey | ZAGPDCPDYOQCGX-FRRDWIJNSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|