C28H28ClF3N8O4 — CID 155222468
5-[7-[2-[[3-chloro-6-[(2S)-2,4-dimethylpiperazin-1-yl]-2-fluoro-4-pyridinyl]amino]-2-oxoethyl]-2,3-dimethyl-4-oxopyrrolo[2,3-d]pyrimidin-5-yl]-3,4-difluoro-2-hydroxybenzamide (PubChem CID 155222468) has the molecular formula C28H28ClF3N8O4 and a molecular weight of 633.03 g/mol. Its IUPAC name is 5-[7-[2-[[3-chloro-6-[(2S)-2,4-dimethylpiperazin-1-yl]-2-fluoro-4-pyridinyl]amino]-2-oxoethyl]-2,3-dimethyl-4-oxopyrrolo[2,3-d]pyrimidin-5-yl]-3,4-difluoro-2-hydroxybenzamide.
| Compound Name | 5-[7-[2-[[3-chloro-6-[(2S)-2,4-dimethylpiperazin-1-yl]-2-fluoro-4-pyridinyl]amino]-2-oxoethyl]-2,3-dimethyl-4-oxopyrrolo[2,3-d]pyrimidin-5-yl]-3,4-difluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 155222468 |
| Molecular Formula | C28H28ClF3N8O4 |
| Molecular Weight | 633.03 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | 5-[7-[2-[[3-chloro-6-[(2S)-2,4-dimethylpiperazin-1-yl]-2-fluoro-4-pyridinyl]amino]-2-oxoethyl]-2,3-dimethyl-4-oxopyrrolo[2,3-d]pyrimidin-5-yl]-3,4-difluoro-2-hydroxybenzamide |
| SMILES | Cc1nc2c(c(-c3cc(C(N)=O)c(O)c(F)c3F)cn2CC(=O)Nc2cc(N3CCN(C)C[C@@H]3C)nc(F)c2Cl)c(=O)n1C |
| InChI | InChI=1S/C28H28ClF3N8O4/c1-12-9-37(3)5-6-40(12)18-8-17(21(29)25(32)36-18)35-19(41)11-39-10-16(20-27(39)34-13(2)38(4)28(20)44)14-7-15(26(33)43)24(42)23(31)22(14)30/h7-8,10,12,42H,5-6,9,11H2,1-4H3,(H2,33,43)(H,35,36,41)/t12-/m0/s1 |
| InChIKey | KQPBJSNLDBRVNH-LBPRGKRZSA-N |
| XLogP | 2.76 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.03 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|