C29H26N6O2 — CID 155223699
1-[4-[5-[2-[hydroxy-(pyridin-4-ylmethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-pyridinyl]phenyl]pyrrolidin-2-one (PubChem CID 155223699) has the molecular formula C29H26N6O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is 1-[4-[5-[2-[hydroxy-(pyridin-4-ylmethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-pyridinyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[5-[2-[hydroxy-(pyridin-4-ylmethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-pyridinyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155223699 |
| Molecular Formula | C29H26N6O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1-[4-[5-[2-[hydroxy-(pyridin-4-ylmethylamino)methyl]-1H-pyrrolo[2,3-b]pyridin-4-yl]-3-pyridinyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(-c2cncc(-c3ccnc4[nH]c(C(O)NCc5ccncc5)cc34)c2)cc1 |
| InChI | InChI=1S/C29H26N6O2/c36-27-2-1-13-35(27)23-5-3-20(4-6-23)21-14-22(18-31-17-21)24-9-12-32-28-25(24)15-26(34-28)29(37)33-16-19-7-10-30-11-8-19/h3-12,14-15,17-18,29,33,37H,1-2,13,16H2,(H,32,34) |
| InChIKey | OEKMLPJFSRZESQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|