C36H56O4 — CID 155223739
hexyl (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate (PubChem CID 155223739) has the molecular formula C36H56O4 and a molecular weight of 552.84 g/mol. Its IUPAC name is hexyl (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate.
| Compound Name | hexyl (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 155223739 |
| Molecular Formula | C36H56O4 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.42 |
| IUPAC Name | hexyl (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bS)-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxylate |
| SMILES | CCCCCCOC(=O)[C@@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]2C1 |
| InChI | InChI=1S/C36H56O4/c1-9-10-11-12-21-40-30(39)33(5)18-17-32(4)19-20-35(7)24(25(32)23-33)22-26(37)29-34(6)15-14-28(38)31(2,3)27(34)13-16-36(29,35)8/h22,25,27,29H,9-21,23H2,1-8H3/t25-,27+,29-,32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | NGYCBCWPOUULNB-SPIUWSAGSA-N |
| XLogP | 8.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|