About [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate
[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate (PubChem CID 155223759) has the molecular formula C20H16F3NO4
and a molecular weight of 391.35 g/mol. Its IUPAC name is [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate |
| PubChem CID | 155223759 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(OC1CC(=O)N(CCc2ccccc2)C1=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO4/c21-20(22,23)15-8-6-14(7-9-15)19(27)28-16-12-17(25)24(18(16)26)11-10-13-4-2-1-3-5-13/h1-9,16H,10-12H2 |
| InChIKey | RPEJPJCIAPEIFK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate?
The IUPAC name of [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate (CID 155223759) is [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate.
What is the SMILES notation for [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate?
The canonical SMILES for [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate is O=C(OC1CC(=O)N(CCc2ccccc2)C1=O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate?
The InChIKey is RPEJPJCIAPEIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F3NO4/c21-20(22,23)15-8-6-14(7-9-15)19(27)28-16-12-17(25)24(18(16)26)11-10-13-4-2-1-3-5-13/h1-9,16H,10-12H2.
What are the key properties of [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate?
[2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate has a molecular weight of 391.35 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dioxo-1-(2-phenylethyl)pyrrolidin-3-yl] 4-(trifluoromethyl)benzoate is sourced from PubChem (CID 155223759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).