About 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine
2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine (PubChem CID 155224179) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine.
Molecular Properties
| Compound Name | 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine |
| PubChem CID | 155224179 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine |
| SMILES | [H]/N=C1\CC(CC)C(C)(C)C1(CC)C(C)(C)C |
| InChI | InChI=1S/C15H29N/c1-8-11-10-12(16)15(9-2,13(3,4)5)14(11,6)7/h11,16H,8-10H2,1-7H3/b16-12+ |
| InChIKey | PXZLYJVPFNXUQJ-FOWTUZBSSA-N |
| XLogP | 4.90 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine?
The IUPAC name of 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine (CID 155224179) is 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine.
What is the SMILES notation for 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine?
The canonical SMILES for 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine is [H]/N=C1\CC(CC)C(C)(C)C1(CC)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine?
The InChIKey is PXZLYJVPFNXUQJ-FOWTUZBSSA-N. The full InChI is InChI=1S/C15H29N/c1-8-11-10-12(16)15(9-2,13(3,4)5)14(11,6)7/h11,16H,8-10H2,1-7H3/b16-12+.
What are the key properties of 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine?
2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine has a molecular weight of 223.40 g/mol, XLogP of 4.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,4-diethyl-3,3-dimethylcyclopentan-1-imine is sourced from PubChem (CID 155224179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).