C21H30ClN3O10P2 — CID 155224437
[[(2R,3S,4R,5S)-5-[2-chloro-4-[(3-hydroxycyclohexyl)methylamino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155224437) has the molecular formula C21H30ClN3O10P2 and a molecular weight of 581.88 g/mol. Its IUPAC name is [[(2R,3S,4R,5S)-5-[2-chloro-4-[(3-hydroxycyclohexyl)methylamino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5S)-5-[2-chloro-4-[(3-hydroxycyclohexyl)methylamino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155224437 |
| Molecular Formula | C21H30ClN3O10P2 |
| Molecular Weight | 581.88 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | [[(2R,3S,4R,5S)-5-[2-chloro-4-[(3-hydroxycyclohexyl)methylamino]quinazolin-7-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](c2ccc3c(NCC4CCCC(O)C4)nc(Cl)nc3c2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H30ClN3O10P2/c22-21-24-15-7-12(4-5-14(15)20(25-21)23-8-11-2-1-3-13(26)6-11)19-18(28)17(27)16(35-19)9-34-37(32,33)10-36(29,30)31/h4-5,7,11,13,16-19,26-28H,1-3,6,8-10H2,(H,32,33)(H,23,24,25)(H2,29,30,31)/t11?,13?,16-,17-,18-,19+/m1/s1 |
| InChIKey | DMZPPBUZNHMWJL-AQDYXPIBSA-N |
| XLogP | 1.75 |
| TPSA | 211.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.88 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|