About CID 155225059
CID 155225059 (PubChem CID 155225059) has the molecular formula C20H29N5NaO4S
and a molecular weight of 458.54 g/mol.
Molecular Properties
| Compound Name | CID 155225059 |
| PubChem CID | 155225059 |
| Molecular Formula | C20H29N5NaO4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | — |
| SMILES | CCc1cc(CC)cc(NC(=O)NS(=O)(=O)N(c2cnn(C)c2)C2CCOCC2)c1.[Na] |
| InChI | InChI=1S/C20H29N5O4S.Na/c1-4-15-10-16(5-2)12-17(11-15)22-20(26)23-30(27,28)25(18-6-8-29-9-7-18)19-13-21-24(3)14-19;/h10-14,18H,4-9H2,1-3H3,(H2,22,23,26); |
| InChIKey | QYANKJDPRIUMAD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 155225059 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155225059?
The IUPAC name of CID 155225059 (CID 155225059) is not available.
What is the SMILES notation for CID 155225059?
The canonical SMILES for CID 155225059 is CCc1cc(CC)cc(NC(=O)NS(=O)(=O)N(c2cnn(C)c2)C2CCOCC2)c1.[Na].
What is the InChIKey of CID 155225059?
The InChIKey is QYANKJDPRIUMAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N5O4S.Na/c1-4-15-10-16(5-2)12-17(11-15)22-20(26)23-30(27,28)25(18-6-8-29-9-7-18)19-13-21-24(3)14-19;/h10-14,18H,4-9H2,1-3H3,(H2,22,23,26);.
What are the key properties of CID 155225059?
CID 155225059 has a molecular weight of 458.54 g/mol, XLogP of 2.22, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155225059 is sourced from PubChem (CID 155225059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).