About 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid
1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 155225262) has the molecular formula C5H6F3N3O2
and a molecular weight of 197.12 g/mol. Its IUPAC name is 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid |
| PubChem CID | 155225262 |
| Molecular Formula | C5H6F3N3O2 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cn[nH]c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C3H5N3.C2HF3O2/c4-3-1-5-6-2-3;3-2(4,5)1(6)7/h1-2H,4H2,(H,5,6);(H,6,7) |
| InChIKey | OALXGAFPXHXRMO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid (CID 155225262) is 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid is Nc1cn[nH]c1.O=C(O)C(F)(F)F.
What is the InChIKey of 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid?
The InChIKey is OALXGAFPXHXRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3.C2HF3O2/c4-3-1-5-6-2-3;3-2(4,5)1(6)7/h1-2H,4H2,(H,5,6);(H,6,7).
What are the key properties of 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid?
1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid has a molecular weight of 197.12 g/mol, XLogP of 0.63, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-4-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 155225262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).