About 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine
1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine (PubChem CID 155225297) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine |
| PubChem CID | 155225297 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine |
| SMILES | Cn1cnc(NC2CCOCC2)n1 |
| InChI | InChI=1S/C8H14N4O/c1-12-6-9-8(11-12)10-7-2-4-13-5-3-7/h6-7H,2-5H2,1H3,(H,10,11) |
| InChIKey | IZZVEQPAWSLECG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine?
The IUPAC name of 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine (CID 155225297) is 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine?
The canonical SMILES for 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine is Cn1cnc(NC2CCOCC2)n1.
What is the InChIKey of 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine?
The InChIKey is IZZVEQPAWSLECG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-12-6-9-8(11-12)10-7-2-4-13-5-3-7/h6-7H,2-5H2,1H3,(H,10,11).
What are the key properties of 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine?
1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine has a molecular weight of 182.23 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(oxan-4-yl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 155225297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).