About (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride
(E)-N,N-dimethylpent-3-en-2-amine;hydrochloride (PubChem CID 155225928) has the molecular formula C7H16ClN
and a molecular weight of 149.66 g/mol. Its IUPAC name is (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride.
Molecular Properties
| Compound Name | (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride |
| PubChem CID | 155225928 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.66 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride |
| SMILES | C/C=C/C(C)N(C)C.Cl |
| InChI | InChI=1S/C7H15N.ClH/c1-5-6-7(2)8(3)4;/h5-7H,1-4H3;1H/b6-5+; |
| InChIKey | WINOBIRRRSPMPM-IPZCTEOASA-N |
| XLogP | 1.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride?
The IUPAC name of (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride (CID 155225928) is (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride.
What is the SMILES notation for (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride?
The canonical SMILES for (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride is C/C=C/C(C)N(C)C.Cl.
What is the InChIKey of (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride?
The InChIKey is WINOBIRRRSPMPM-IPZCTEOASA-N. The full InChI is InChI=1S/C7H15N.ClH/c1-5-6-7(2)8(3)4;/h5-7H,1-4H3;1H/b6-5+;.
What are the key properties of (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride?
(E)-N,N-dimethylpent-3-en-2-amine;hydrochloride has a molecular weight of 149.66 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethylpent-3-en-2-amine;hydrochloride is sourced from PubChem (CID 155225928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).