C28H31F3N4O3 — CID 155226007
2-[2-(3,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethyl)-1H-indol-5-yl]-5-(1-propan-2-ylpiperidin-4-yl)-1,3,4-oxadiazole (PubChem CID 155226007) has the molecular formula C28H31F3N4O3 and a molecular weight of 528.58 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethyl)-1H-indol-5-yl]-5-(1-propan-2-ylpiperidin-4-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethyl)-1H-indol-5-yl]-5-(1-propan-2-ylpiperidin-4-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 155226007 |
| Molecular Formula | C28H31F3N4O3 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-3-(2,2,2-trifluoroethyl)-1H-indol-5-yl]-5-(1-propan-2-ylpiperidin-4-yl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2[nH]c3ccc(-c4nnc(C5CCN(C(C)C)CC5)o4)cc3c2CC(F)(F)F)cc1OC |
| InChI | InChI=1S/C28H31F3N4O3/c1-16(2)35-11-9-17(10-12-35)26-33-34-27(38-26)19-5-7-22-20(13-19)21(15-28(29,30)31)25(32-22)18-6-8-23(36-3)24(14-18)37-4/h5-8,13-14,16-17,32H,9-12,15H2,1-4H3 |
| InChIKey | IWUYAMGCFIPSAN-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 76.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |