C28H36FN7O — CID 155226054
6-[4-fluoro-5-[2-methyl-4-(oxan-4-yl)piperazin-1-yl]-3-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 155226054) has the molecular formula C28H36FN7O and a molecular weight of 505.64 g/mol. Its IUPAC name is 6-[4-fluoro-5-[2-methyl-4-(oxan-4-yl)piperazin-1-yl]-3-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[4-fluoro-5-[2-methyl-4-(oxan-4-yl)piperazin-1-yl]-3-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 155226054 |
| Molecular Formula | C28H36FN7O |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 6-[4-fluoro-5-[2-methyl-4-(oxan-4-yl)piperazin-1-yl]-3-propan-2-yl-1H-pyrrolo[2,3-c]pyridin-2-yl]-7,8-dimethyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1c(-c2[nH]c3cnc(N4CCN(C5CCOCC5)CC4C)c(F)c3c2C(C)C)cn2ncnc2c1C |
| InChI | InChI=1S/C28H36FN7O/c1-16(2)23-24-22(33-26(23)21-14-36-27(31-15-32-36)19(5)18(21)4)12-30-28(25(24)29)35-9-8-34(13-17(35)3)20-6-10-37-11-7-20/h12,14-17,20,33H,6-11,13H2,1-5H3 |
| InChIKey | DSVSQYPDZFAFFX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |