C22H20N2O — CID 155226477
(3Z,8E,10Z)-2,2-dimethyl-6-phenyl-7-oxa-5-azatricyclo[10.4.0.04,8]hexadeca-1(16),3,5,8,10,12,14-heptaen-11-amine (PubChem CID 155226477) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is (3Z,8E,10Z)-2,2-dimethyl-6-phenyl-7-oxa-5-azatricyclo[10.4.0.04,8]hexadeca-1(16),3,5,8,10,12,14-heptaen-11-amine.
| Compound Name | (3Z,8E,10Z)-2,2-dimethyl-6-phenyl-7-oxa-5-azatricyclo[10.4.0.04,8]hexadeca-1(16),3,5,8,10,12,14-heptaen-11-amine |
|---|---|
| PubChem CID | 155226477 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (3Z,8E,10Z)-2,2-dimethyl-6-phenyl-7-oxa-5-azatricyclo[10.4.0.04,8]hexadeca-1(16),3,5,8,10,12,14-heptaen-11-amine |
| SMILES | CC1(C)/C=c2\nc(-c3ccccc3)o\c2=C\C=C(/N)c2ccccc21 |
| InChI | InChI=1S/C22H20N2O/c1-22(2)14-19-20(25-21(24-19)15-8-4-3-5-9-15)13-12-18(23)16-10-6-7-11-17(16)22/h3-14H,23H2,1-2H3/b18-12-,19-14+,20-13+ |
| InChIKey | GNVNYRVVEOVCCH-ZDONSGIESA-N |
| XLogP | 3.19 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |