C14H19F3N2OS2 — CID 155226611
(E)-N-(3-methylbutoxy)-2-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]ethanimine (PubChem CID 155226611) has the molecular formula C14H19F3N2OS2 and a molecular weight of 352.45 g/mol. Its IUPAC name is (E)-N-(3-methylbutoxy)-2-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]ethanimine.
| Compound Name | (E)-N-(3-methylbutoxy)-2-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]ethanimine |
|---|---|
| PubChem CID | 155226611 |
| Molecular Formula | C14H19F3N2OS2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (E)-N-(3-methylbutoxy)-2-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]ethanimine |
| SMILES | CC(C)CCO/N=C/Cc1cnc(SCCC(F)=C(F)F)s1 |
| InChI | InChI=1S/C14H19F3N2OS2/c1-10(2)4-7-20-19-6-3-11-9-18-14(22-11)21-8-5-12(15)13(16)17/h6,9-10H,3-5,7-8H2,1-2H3/b19-6+ |
| InChIKey | XNDOHMJLAROPIT-KPSZGOFPSA-N |
| XLogP | 5.29 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|