C11H13F3N2O4S — CID 155226621
(E)-N-ethoxy-2-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]ethanimine (PubChem CID 155226621) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is (E)-N-ethoxy-2-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]ethanimine.
| Compound Name | (E)-N-ethoxy-2-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]ethanimine |
|---|---|
| PubChem CID | 155226621 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (E)-N-ethoxy-2-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-oxazol-5-yl]ethanimine |
| SMILES | CCO/N=C/Cc1cnc(S(=O)(=O)CCC(F)=C(F)F)o1 |
| InChI | InChI=1S/C11H13F3N2O4S/c1-2-19-16-5-3-8-7-15-11(20-8)21(17,18)6-4-9(12)10(13)14/h5,7H,2-4,6H2,1H3/b16-5+ |
| InChIKey | ORVSDUHRXCIYOK-FZSIALSZSA-N |
| XLogP | 2.48 |
| TPSA | 81.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|