C13H15F3N2O3S2 — CID 155226654
(E)-N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-thiazol-5-yl]ethanimine (PubChem CID 155226654) has the molecular formula C13H15F3N2O3S2 and a molecular weight of 368.40 g/mol. Its IUPAC name is (E)-N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-thiazol-5-yl]ethanimine.
| Compound Name | (E)-N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-thiazol-5-yl]ethanimine |
|---|---|
| PubChem CID | 155226654 |
| Molecular Formula | C13H15F3N2O3S2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (E)-N-(cyclopropylmethoxy)-1-[2-(3,4,4-trifluorobut-3-enylsulfonyl)-1,3-thiazol-5-yl]ethanimine |
| SMILES | C/C(=N\OCC1CC1)c1cnc(S(=O)(=O)CCC(F)=C(F)F)s1 |
| InChI | InChI=1S/C13H15F3N2O3S2/c1-8(18-21-7-9-2-3-9)11-6-17-13(22-11)23(19,20)5-4-10(14)12(15)16/h6,9H,2-5,7H2,1H3/b18-8+ |
| InChIKey | LCCSXJXXFQAHAI-QGMBQPNBSA-N |
| XLogP | 3.54 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|