C15H13F3N2OS2 — CID 155226743
(E)-N-phenylmethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methanimine (PubChem CID 155226743) has the molecular formula C15H13F3N2OS2 and a molecular weight of 358.41 g/mol. Its IUPAC name is (E)-N-phenylmethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methanimine.
| Compound Name | (E)-N-phenylmethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methanimine |
|---|---|
| PubChem CID | 155226743 |
| Molecular Formula | C15H13F3N2OS2 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (E)-N-phenylmethoxy-1-[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methanimine |
| SMILES | FC(F)=C(F)CCSc1ncc(/C=N/OCc2ccccc2)s1 |
| InChI | InChI=1S/C15H13F3N2OS2/c16-13(14(17)18)6-7-22-15-19-8-12(23-15)9-20-21-10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2/b20-9+ |
| InChIKey | SRANEVCJFPAHID-AWQFTUOYSA-N |
| XLogP | 5.25 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|