C8H7F3N2OS2 — CID 155226750
(NE)-N-[[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methylidene]hydroxylamine (PubChem CID 155226750) has the molecular formula C8H7F3N2OS2 and a molecular weight of 268.28 g/mol. Its IUPAC name is (NE)-N-[[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 155226750 |
| Molecular Formula | C8H7F3N2OS2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | (NE)-N-[[2-(3,4,4-trifluorobut-3-enylsulfanyl)-1,3-thiazol-5-yl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1cnc(SCCC(F)=C(F)F)s1 |
| InChI | InChI=1S/C8H7F3N2OS2/c9-6(7(10)11)1-2-15-8-12-3-5(16-8)4-13-14/h3-4,14H,1-2H2/b13-4+ |
| InChIKey | UEXZFGBCPXUZBD-YIXHJXPBSA-N |
| XLogP | 3.51 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|