About (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile
(3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile (PubChem CID 155227146) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile.
Molecular Properties
| Compound Name | (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile |
| PubChem CID | 155227146 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile |
| SMILES | CCCc1cccnc1[C@@]1(OC)C=C(C#N)C(=O)C(C)(C)C1 |
| InChI | InChI=1S/C18H22N2O2/c1-5-7-13-8-6-9-20-15(13)18(22-4)10-14(11-19)16(21)17(2,3)12-18/h6,8-10H,5,7,12H2,1-4H3/t18-/m1/s1 |
| InChIKey | FOLHYWCHSAGABX-GOSISDBHSA-N |
| XLogP | 3.32 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile?
The IUPAC name of (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile (CID 155227146) is (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile.
What is the SMILES notation for (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile?
The canonical SMILES for (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile is CCCc1cccnc1[C@@]1(OC)C=C(C#N)C(=O)C(C)(C)C1.
What is the InChIKey of (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile?
The InChIKey is FOLHYWCHSAGABX-GOSISDBHSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-5-7-13-8-6-9-20-15(13)18(22-4)10-14(11-19)16(21)17(2,3)12-18/h6,8-10H,5,7,12H2,1-4H3/t18-/m1/s1.
What are the key properties of (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile?
(3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile has a molecular weight of 298.39 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methoxy-5,5-dimethyl-6-oxo-3-(3-propyl-2-pyridinyl)cyclohexene-1-carbonitrile is sourced from PubChem (CID 155227146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).