C24H22N4O — CID 155227317
1-[4-[5-(1,3-dimethylpyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]phenyl]pyrrolidin-2-one (PubChem CID 155227317) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-[4-[5-(1,3-dimethylpyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[5-(1,3-dimethylpyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155227317 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-[4-[5-(1,3-dimethylpyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]phenyl]pyrrolidin-2-one |
| SMILES | Cc1cn(C)c2nccc(-c3cncc(-c4ccc(N5CCCC5=O)cc4)c3)c12 |
| InChI | InChI=1S/C24H22N4O/c1-16-15-27(2)24-23(16)21(9-10-26-24)19-12-18(13-25-14-19)17-5-7-20(8-6-17)28-11-3-4-22(28)29/h5-10,12-15H,3-4,11H2,1-2H3 |
| InChIKey | WRHZKHRQQHKGSZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|