C12H8ClIN4 — CID 155227839
2-chloro-N-(4-iodophenyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 155227839) has the molecular formula C12H8ClIN4 and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-chloro-N-(4-iodophenyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-chloro-N-(4-iodophenyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 155227839 |
| Molecular Formula | C12H8ClIN4 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 2-chloro-N-(4-iodophenyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Clc1nc(Nc2ccc(I)cc2)c2cccn2n1 |
| InChI | InChI=1S/C12H8ClIN4/c13-12-16-11(10-2-1-7-18(10)17-12)15-9-5-3-8(14)4-6-9/h1-7H,(H,15,16,17) |
| InChIKey | QNCMXBKFVMQDBQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|