C10H13FO3S — CID 155228051
(4Z,6E)-5-fluoro-4-methyl-6-methylsulfonylocta-1,4,6-trien-3-one (PubChem CID 155228051) has the molecular formula C10H13FO3S and a molecular weight of 232.28 g/mol. Its IUPAC name is (4Z,6E)-5-fluoro-4-methyl-6-methylsulfonylocta-1,4,6-trien-3-one.
| Compound Name | (4Z,6E)-5-fluoro-4-methyl-6-methylsulfonylocta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 155228051 |
| Molecular Formula | C10H13FO3S |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (4Z,6E)-5-fluoro-4-methyl-6-methylsulfonylocta-1,4,6-trien-3-one |
| SMILES | C=CC(=O)/C(C)=C(F)/C(=C\C)S(C)(=O)=O |
| InChI | InChI=1S/C10H13FO3S/c1-5-8(12)7(3)10(11)9(6-2)15(4,13)14/h5-6H,1H2,2-4H3/b9-6+,10-7- |
| InChIKey | JKIOBLIRKNJPHK-FPXDHTHPSA-N |
| XLogP | 1.93 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|