C10H14N2O3S — CID 155228072
(3E,5E)-8-imino-5,6-dimethyl-7-oxoocta-1,3,5-triene-4-sulfonamide (PubChem CID 155228072) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is (3E,5E)-8-imino-5,6-dimethyl-7-oxoocta-1,3,5-triene-4-sulfonamide.
| Compound Name | (3E,5E)-8-imino-5,6-dimethyl-7-oxoocta-1,3,5-triene-4-sulfonamide |
|---|---|
| PubChem CID | 155228072 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (3E,5E)-8-imino-5,6-dimethyl-7-oxoocta-1,3,5-triene-4-sulfonamide |
| SMILES | [H]/N=C/C(=O)/C(C)=C(C)/C(=C\C=C)S(N)(=O)=O |
| InChI | InChI=1S/C10H14N2O3S/c1-4-5-10(16(12,14)15)8(3)7(2)9(13)6-11/h4-6,11H,1H2,2-3H3,(H2,12,14,15)/b8-7+,10-5+,11-6+ |
| InChIKey | MOLATIMLAKKUHX-WGVLWLRPSA-N |
| XLogP | 0.90 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|