C15H33N3O — CID 155228412
N'-[(2S,4R)-2-(aminomethyl)-4-(2-methylpropoxy)cyclobutyl]-N-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 155228412) has the molecular formula C15H33N3O and a molecular weight of 271.44 g/mol. Its IUPAC name is N'-[(2S,4R)-2-(aminomethyl)-4-(2-methylpropoxy)cyclobutyl]-N-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-[(2S,4R)-2-(aminomethyl)-4-(2-methylpropoxy)cyclobutyl]-N-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 155228412 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | N'-[(2S,4R)-2-(aminomethyl)-4-(2-methylpropoxy)cyclobutyl]-N-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCNC1[C@@H](C[C@H]1OCC(C)C)CN |
| InChI | InChI=1S/C15H33N3O/c1-11(2)9-17-5-6-18-15-13(8-16)7-14(15)19-10-12(3)4/h11-15,17-18H,5-10,16H2,1-4H3/t13-,14+,15?/m0/s1 |
| InChIKey | TWURGGUSXURMPQ-SNTRVMSOSA-N |
| XLogP | 2.00 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | 233 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|